About 2-oxo-3-(2,2,2-trifluoroethyl)-1,3-oxazinane-5-carboxylic acid
2-oxo-3-(2,2,2-trifluoroethyl)-1,3-oxazinane-5-carboxylic acid (PubChem CID 83850099) has the molecular formula C7H8F3NO4
and a molecular weight of 227.14 g/mol. Its IUPAC name is 2-oxo-3-(2,2,2-trifluoroethyl)-1,3-oxazinane-5-carboxylic acid.
Analyze 2-oxo-3-(2,2,2-trifluoroethyl)-1,3-oxazinane-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-3-(2,2,2-trifluoroethyl)-1,3-oxazinane-5-carboxylic acid?
The IUPAC name of 2-oxo-3-(2,2,2-trifluoroethyl)-1,3-oxazinane-5-carboxylic acid (CID 83850099) is 2-oxo-3-(2,2,2-trifluoroethyl)-1,3-oxazinane-5-carboxylic acid.
What is the SMILES notation for 2-oxo-3-(2,2,2-trifluoroethyl)-1,3-oxazinane-5-carboxylic acid?
The canonical SMILES for 2-oxo-3-(2,2,2-trifluoroethyl)-1,3-oxazinane-5-carboxylic acid is O=C(O)C1COC(=O)N(CC(F)(F)F)C1.
What is the InChIKey of 2-oxo-3-(2,2,2-trifluoroethyl)-1,3-oxazinane-5-carboxylic acid?
The InChIKey is XMCJHSZEWXEOOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F3NO4/c8-7(9,10)3-11-1-4(5(12)13)2-15-6(11)14/h4H,1-3H2,(H,12,13).
What are the key properties of 2-oxo-3-(2,2,2-trifluoroethyl)-1,3-oxazinane-5-carboxylic acid?
2-oxo-3-(2,2,2-trifluoroethyl)-1,3-oxazinane-5-carboxylic acid has a molecular weight of 227.14 g/mol, XLogP of 0.70, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-3-(2,2,2-trifluoroethyl)-1,3-oxazinane-5-carboxylic acid is sourced from PubChem (CID 83850099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).