C7H11NO4 — CID 83846284
3-ethyl-2-oxo-1,3-oxazinane-5-carboxylic acid (PubChem CID 83846284) has the molecular formula C7H11NO4 and a molecular weight of 173.17 g/mol. Its IUPAC name is 3-ethyl-2-oxo-1,3-oxazinane-5-carboxylic acid.
| Compound Name | 3-ethyl-2-oxo-1,3-oxazinane-5-carboxylic acid |
|---|---|
| PubChem CID | 83846284 |
| Molecular Formula | C7H11NO4 |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | 3-ethyl-2-oxo-1,3-oxazinane-5-carboxylic acid |
| SMILES | CCN1CC(C(=O)O)COC1=O |
| InChI | InChI=1S/C7H11NO4/c1-2-8-3-5(6(9)10)4-12-7(8)11/h5H,2-4H2,1H3,(H,9,10) |
| InChIKey | JTDUHPDAOZKFFJ-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |