2-[2-oxo-3-(oxolan-2-ylmethyl)-1,3-oxazinan-4-yl]acetic acid

C11H17NO5 — CID 117011247

IUPAC2-[2-oxo-3-(oxolan-2-ylmethyl)-1,3-oxazinan-4-yl]acetic acid
SMILESO=C(O)CC1CCOC(=O)N1CC1CCCO1
InChIInChI=1S/C11H17NO5/c13-10(14)6-8-3-5-17-11(15)12(8)7-9-2-1-4-16-9/h8-9H,1-7H2,(H,13,14)
InChIKeyOKJQVSGREZIHHG-UHFFFAOYSA-N
MW243.26 g/mol
LogP0.85
Rot. Bonds4

About 2-[2-oxo-3-(oxolan-2-ylmethyl)-1,3-oxazinan-4-yl]acetic acid

2-[2-oxo-3-(oxolan-2-ylmethyl)-1,3-oxazinan-4-yl]acetic acid (PubChem CID 117011247) has the molecular formula C11H17NO5 and a molecular weight of 243.26 g/mol. Its IUPAC name is 2-[2-oxo-3-(oxolan-2-ylmethyl)-1,3-oxazinan-4-yl]acetic acid.

Molecular Properties

Compound Name2-[2-oxo-3-(oxolan-2-ylmethyl)-1,3-oxazinan-4-yl]acetic acid
PubChem CID117011247
Molecular FormulaC11H17NO5
Molecular Weight243.26 g/mol
Exact Mass243.11
IUPAC Name2-[2-oxo-3-(oxolan-2-ylmethyl)-1,3-oxazinan-4-yl]acetic acid
SMILESO=C(O)CC1CCOC(=O)N1CC1CCCO1
InChIInChI=1S/C11H17NO5/c13-10(14)6-8-3-5-17-11(15)12(8)7-9-2-1-4-16-9/h8-9H,1-7H2,(H,13,14)
InChIKeyOKJQVSGREZIHHG-UHFFFAOYSA-N
XLogP0.85
TPSA76.07 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.26
LogP ≤ 50.85
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[2-oxo-3-(oxolan-2-ylmethyl)-1,3-oxazinan-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-oxo-3-(oxolan-2-ylmethyl)-1,3-oxazinan-4-yl]acetic acid?
The IUPAC name of 2-[2-oxo-3-(oxolan-2-ylmethyl)-1,3-oxazinan-4-yl]acetic acid (CID 117011247) is 2-[2-oxo-3-(oxolan-2-ylmethyl)-1,3-oxazinan-4-yl]acetic acid.
What is the SMILES notation for 2-[2-oxo-3-(oxolan-2-ylmethyl)-1,3-oxazinan-4-yl]acetic acid?
The canonical SMILES for 2-[2-oxo-3-(oxolan-2-ylmethyl)-1,3-oxazinan-4-yl]acetic acid is O=C(O)CC1CCOC(=O)N1CC1CCCO1.
What is the InChIKey of 2-[2-oxo-3-(oxolan-2-ylmethyl)-1,3-oxazinan-4-yl]acetic acid?
The InChIKey is OKJQVSGREZIHHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO5/c13-10(14)6-8-3-5-17-11(15)12(8)7-9-2-1-4-16-9/h8-9H,1-7H2,(H,13,14).
What are the key properties of 2-[2-oxo-3-(oxolan-2-ylmethyl)-1,3-oxazinan-4-yl]acetic acid?
2-[2-oxo-3-(oxolan-2-ylmethyl)-1,3-oxazinan-4-yl]acetic acid has a molecular weight of 243.26 g/mol, XLogP of 0.85, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-oxo-3-(oxolan-2-ylmethyl)-1,3-oxazinan-4-yl]acetic acid is sourced from PubChem (CID 117011247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).