C13H20N2 — CID 117016074
4-propyl-2,3,5,6-tetrahydro-1H-1,4-benzodiazocine (PubChem CID 117016074) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 4-propyl-2,3,5,6-tetrahydro-1H-1,4-benzodiazocine.
| Compound Name | 4-propyl-2,3,5,6-tetrahydro-1H-1,4-benzodiazocine |
|---|---|
| PubChem CID | 117016074 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 4-propyl-2,3,5,6-tetrahydro-1H-1,4-benzodiazocine |
| SMILES | CCCN1CCNc2ccccc2CC1 |
| InChI | InChI=1S/C13H20N2/c1-2-9-15-10-7-12-5-3-4-6-13(12)14-8-11-15/h3-6,14H,2,7-11H2,1H3 |
| InChIKey | WFQZDLSGTCHTPI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |