C12H16Cl2N2 — CID 117017057
1-(2,3-dichlorophenyl)-2,2-dimethylpyrrolidin-3-amine (PubChem CID 117017057) has the molecular formula C12H16Cl2N2 and a molecular weight of 259.18 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-2,2-dimethylpyrrolidin-3-amine.
| Compound Name | 1-(2,3-dichlorophenyl)-2,2-dimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 117017057 |
| Molecular Formula | C12H16Cl2N2 |
| Molecular Weight | 259.18 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-2,2-dimethylpyrrolidin-3-amine |
| SMILES | CC1(C)C(N)CCN1c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C12H16Cl2N2/c1-12(2)10(15)6-7-16(12)9-5-3-4-8(13)11(9)14/h3-5,10H,6-7,15H2,1-2H3 |
| InChIKey | XRXNSBZPGHBRIN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.18 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |