C17H28N2 — CID 117019215
1-(2-tert-butylphenyl)-2,2-dimethylpiperidin-3-amine (PubChem CID 117019215) has the molecular formula C17H28N2 and a molecular weight of 260.43 g/mol. Its IUPAC name is 1-(2-tert-butylphenyl)-2,2-dimethylpiperidin-3-amine.
| Compound Name | 1-(2-tert-butylphenyl)-2,2-dimethylpiperidin-3-amine |
|---|---|
| PubChem CID | 117019215 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | 1-(2-tert-butylphenyl)-2,2-dimethylpiperidin-3-amine |
| SMILES | CC(C)(C)c1ccccc1N1CCCC(N)C1(C)C |
| InChI | InChI=1S/C17H28N2/c1-16(2,3)13-9-6-7-10-14(13)19-12-8-11-15(18)17(19,4)5/h6-7,9-10,15H,8,11-12,18H2,1-5H3 |
| InChIKey | CYCNRNPCWSZFNI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |