C14H21BrN2 — CID 117017594
2-[1-(2-bromophenyl)-2,2-dimethylpyrrolidin-3-yl]ethanamine (PubChem CID 117017594) has the molecular formula C14H21BrN2 and a molecular weight of 297.24 g/mol. Its IUPAC name is 2-[1-(2-bromophenyl)-2,2-dimethylpyrrolidin-3-yl]ethanamine.
| Compound Name | 2-[1-(2-bromophenyl)-2,2-dimethylpyrrolidin-3-yl]ethanamine |
|---|---|
| PubChem CID | 117017594 |
| Molecular Formula | C14H21BrN2 |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 2-[1-(2-bromophenyl)-2,2-dimethylpyrrolidin-3-yl]ethanamine |
| SMILES | CC1(C)C(CCN)CCN1c1ccccc1Br |
| InChI | InChI=1S/C14H21BrN2/c1-14(2)11(7-9-16)8-10-17(14)13-6-4-3-5-12(13)15/h3-6,11H,7-10,16H2,1-2H3 |
| InChIKey | NXYVFWDCWXDNNJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |