C12H14BrNO — CID 117016957
1-(2-bromophenyl)-2,2-dimethylpyrrolidin-3-one (PubChem CID 117016957) has the molecular formula C12H14BrNO and a molecular weight of 268.15 g/mol. Its IUPAC name is 1-(2-bromophenyl)-2,2-dimethylpyrrolidin-3-one.
| Compound Name | 1-(2-bromophenyl)-2,2-dimethylpyrrolidin-3-one |
|---|---|
| PubChem CID | 117016957 |
| Molecular Formula | C12H14BrNO |
| Molecular Weight | 268.15 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 1-(2-bromophenyl)-2,2-dimethylpyrrolidin-3-one |
| SMILES | CC1(C)C(=O)CCN1c1ccccc1Br |
| InChI | InChI=1S/C12H14BrNO/c1-12(2)11(15)7-8-14(12)10-6-4-3-5-9(10)13/h3-6H,7-8H2,1-2H3 |
| InChIKey | ZKSYGGIDUXPANN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.15 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |