C14H22N2O2 — CID 117022204
[1-(2,5-dimethoxyphenyl)-2-methylpyrrolidin-3-yl]methanamine (PubChem CID 117022204) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is [1-(2,5-dimethoxyphenyl)-2-methylpyrrolidin-3-yl]methanamine.
| Compound Name | [1-(2,5-dimethoxyphenyl)-2-methylpyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 117022204 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | [1-(2,5-dimethoxyphenyl)-2-methylpyrrolidin-3-yl]methanamine |
| SMILES | COc1ccc(OC)c(N2CCC(CN)C2C)c1 |
| InChI | InChI=1S/C14H22N2O2/c1-10-11(9-15)6-7-16(10)13-8-12(17-2)4-5-14(13)18-3/h4-5,8,10-11H,6-7,9,15H2,1-3H3 |
| InChIKey | ZZNBNCBMVFPJAV-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |