C19H30O3 — CID 11702257
2-[(6Z,9Z,12Z,15Z)-heptadeca-6,9,12,15-tetraenoxy]acetic acid (PubChem CID 11702257) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is 2-[(6Z,9Z,12Z,15Z)-heptadeca-6,9,12,15-tetraenoxy]acetic acid.
| Compound Name | 2-[(6Z,9Z,12Z,15Z)-heptadeca-6,9,12,15-tetraenoxy]acetic acid |
|---|---|
| PubChem CID | 11702257 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | 2-[(6Z,9Z,12Z,15Z)-heptadeca-6,9,12,15-tetraenoxy]acetic acid |
| SMILES | C/C=C\C/C=C\C/C=C\C/C=C\CCCCCOCC(=O)O |
| InChI | InChI=1S/C19H30O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22-18-19(20)21/h2-3,5-6,8-9,11-12H,4,7,10,13-18H2,1H3,(H,20,21)/b3-2-,6-5-,9-8-,12-11- |
| InChIKey | AHDGPYWABRMJQW-BKGCKSHMSA-N |
| XLogP | 5.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|