2-dodec-8-enoxyacetic acid

C14H26O3 — CID 175547698

IUPAC2-dodec-8-enoxyacetic acid
SMILESCCCC=CCCCCCCCOCC(=O)O
InChIInChI=1S/C14H26O3/c1-2-3-4-5-6-7-8-9-10-11-12-17-13-14(15)16/h4-5H,2-3,6-13H2,1H3,(H,15,16)
InChIKeyGLESSGPCGXGNTE-UHFFFAOYSA-N
MW242.36 g/mol
LogP3.78
Rot. Bonds12

About 2-dodec-8-enoxyacetic acid

2-dodec-8-enoxyacetic acid (PubChem CID 175547698) has the molecular formula C14H26O3 and a molecular weight of 242.36 g/mol. Its IUPAC name is 2-dodec-8-enoxyacetic acid.

Molecular Properties

Compound Name2-dodec-8-enoxyacetic acid
PubChem CID175547698
Molecular FormulaC14H26O3
Molecular Weight242.36 g/mol
Exact Mass242.19
IUPAC Name2-dodec-8-enoxyacetic acid
SMILESCCCC=CCCCCCCCOCC(=O)O
InChIInChI=1S/C14H26O3/c1-2-3-4-5-6-7-8-9-10-11-12-17-13-14(15)16/h4-5H,2-3,6-13H2,1H3,(H,15,16)
InChIKeyGLESSGPCGXGNTE-UHFFFAOYSA-N
XLogP3.78
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds12
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.36
LogP ≤ 53.78
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2-dodec-8-enoxyacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-dodec-8-enoxyacetic acid?
The IUPAC name of 2-dodec-8-enoxyacetic acid (CID 175547698) is 2-dodec-8-enoxyacetic acid.
What is the SMILES notation for 2-dodec-8-enoxyacetic acid?
The canonical SMILES for 2-dodec-8-enoxyacetic acid is CCCC=CCCCCCCCOCC(=O)O.
What is the InChIKey of 2-dodec-8-enoxyacetic acid?
The InChIKey is GLESSGPCGXGNTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O3/c1-2-3-4-5-6-7-8-9-10-11-12-17-13-14(15)16/h4-5H,2-3,6-13H2,1H3,(H,15,16).
What are the key properties of 2-dodec-8-enoxyacetic acid?
2-dodec-8-enoxyacetic acid has a molecular weight of 242.36 g/mol, XLogP of 3.78, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-dodec-8-enoxyacetic acid is sourced from PubChem (CID 175547698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).