C14H26O3 — CID 175547698
2-dodec-8-enoxyacetic acid (PubChem CID 175547698) has the molecular formula C14H26O3 and a molecular weight of 242.36 g/mol. Its IUPAC name is 2-dodec-8-enoxyacetic acid.
| Compound Name | 2-dodec-8-enoxyacetic acid |
|---|---|
| PubChem CID | 175547698 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | 2-dodec-8-enoxyacetic acid |
| SMILES | CCCC=CCCCCCCCOCC(=O)O |
| InChI | InChI=1S/C14H26O3/c1-2-3-4-5-6-7-8-9-10-11-12-17-13-14(15)16/h4-5H,2-3,6-13H2,1H3,(H,15,16) |
| InChIKey | GLESSGPCGXGNTE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|