C20H33NO5 — CID 52913128
2-[(6E,9E,12E)-11-nitrooctadeca-6,9,12-trienoxy]acetic acid (PubChem CID 52913128) has the molecular formula C20H33NO5 and a molecular weight of 367.49 g/mol. Its IUPAC name is 2-[(6E,9E,12E)-11-nitrooctadeca-6,9,12-trienoxy]acetic acid.
| Compound Name | 2-[(6E,9E,12E)-11-nitrooctadeca-6,9,12-trienoxy]acetic acid |
|---|---|
| PubChem CID | 52913128 |
| Molecular Formula | C20H33NO5 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | 2-[(6E,9E,12E)-11-nitrooctadeca-6,9,12-trienoxy]acetic acid |
| SMILES | CCCCC/C=C/C(/C=C/C/C=C/CCCCCOCC(=O)O)[N+](=O)[O-] |
| InChI | InChI=1S/C20H33NO5/c1-2-3-4-9-12-15-19(21(24)25)16-13-10-7-5-6-8-11-14-17-26-18-20(22)23/h5,7,12-13,15-16,19H,2-4,6,8-11,14,17-18H2,1H3,(H,22,23)/b7-5+,15-12+,16-13+ |
| InChIKey | NJWQTNJLGDDJIM-YBKDTCGRSA-N |
| XLogP | 4.93 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|