C11H22N2O — CID 117023395
4-tert-butyl-7,7-dimethyl-1,4-diazepan-5-one (PubChem CID 117023395) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is 4-tert-butyl-7,7-dimethyl-1,4-diazepan-5-one.
| Compound Name | 4-tert-butyl-7,7-dimethyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 117023395 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | 4-tert-butyl-7,7-dimethyl-1,4-diazepan-5-one |
| SMILES | CC1(C)CC(=O)N(C(C)(C)C)CCN1 |
| InChI | InChI=1S/C11H22N2O/c1-10(2,3)13-7-6-12-11(4,5)8-9(13)14/h12H,6-8H2,1-5H3 |
| InChIKey | UMBLFYPEYUKEAU-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |