About 4-tert-butyl-7,7-dimethyl-1,4-diazepan-5-one
4-tert-butyl-7,7-dimethyl-1,4-diazepan-5-one (PubChem CID 117023395) has the molecular formula C11H22N2O
and a molecular weight of 198.31 g/mol. Its IUPAC name is 4-tert-butyl-7,7-dimethyl-1,4-diazepan-5-one.
Molecular Properties
| Compound Name | 4-tert-butyl-7,7-dimethyl-1,4-diazepan-5-one |
| PubChem CID | 117023395 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | 4-tert-butyl-7,7-dimethyl-1,4-diazepan-5-one |
| SMILES | CC1(C)CC(=O)N(C(C)(C)C)CCN1 |
| InChI | InChI=1S/C11H22N2O/c1-10(2,3)13-7-6-12-11(4,5)8-9(13)14/h12H,6-8H2,1-5H3 |
| InChIKey | UMBLFYPEYUKEAU-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-tert-butyl-7,7-dimethyl-1,4-diazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-7,7-dimethyl-1,4-diazepan-5-one?
The IUPAC name of 4-tert-butyl-7,7-dimethyl-1,4-diazepan-5-one (CID 117023395) is 4-tert-butyl-7,7-dimethyl-1,4-diazepan-5-one.
What is the SMILES notation for 4-tert-butyl-7,7-dimethyl-1,4-diazepan-5-one?
The canonical SMILES for 4-tert-butyl-7,7-dimethyl-1,4-diazepan-5-one is CC1(C)CC(=O)N(C(C)(C)C)CCN1.
What is the InChIKey of 4-tert-butyl-7,7-dimethyl-1,4-diazepan-5-one?
The InChIKey is UMBLFYPEYUKEAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O/c1-10(2,3)13-7-6-12-11(4,5)8-9(13)14/h12H,6-8H2,1-5H3.
What are the key properties of 4-tert-butyl-7,7-dimethyl-1,4-diazepan-5-one?
4-tert-butyl-7,7-dimethyl-1,4-diazepan-5-one has a molecular weight of 198.31 g/mol, XLogP of 1.39, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-7,7-dimethyl-1,4-diazepan-5-one is sourced from PubChem (CID 117023395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).