C13H17ClN2O — CID 117023419
4-(4-chlorophenyl)-7,7-dimethyl-1,4-diazepan-5-one (PubChem CID 117023419) has the molecular formula C13H17ClN2O and a molecular weight of 252.75 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-7,7-dimethyl-1,4-diazepan-5-one.
| Compound Name | 4-(4-chlorophenyl)-7,7-dimethyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 117023419 |
| Molecular Formula | C13H17ClN2O |
| Molecular Weight | 252.75 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 4-(4-chlorophenyl)-7,7-dimethyl-1,4-diazepan-5-one |
| SMILES | CC1(C)CC(=O)N(c2ccc(Cl)cc2)CCN1 |
| InChI | InChI=1S/C13H17ClN2O/c1-13(2)9-12(17)16(8-7-15-13)11-5-3-10(14)4-6-11/h3-6,15H,7-9H2,1-2H3 |
| InChIKey | NHSDPLLOPXSLOF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.75 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |