C12H15ClN2O — CID 117024062
4-(4-chlorophenyl)-5,5-dimethylpiperazin-2-one (PubChem CID 117024062) has the molecular formula C12H15ClN2O and a molecular weight of 238.72 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-5,5-dimethylpiperazin-2-one.
| Compound Name | 4-(4-chlorophenyl)-5,5-dimethylpiperazin-2-one |
|---|---|
| PubChem CID | 117024062 |
| Molecular Formula | C12H15ClN2O |
| Molecular Weight | 238.72 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 4-(4-chlorophenyl)-5,5-dimethylpiperazin-2-one |
| SMILES | CC1(C)CNC(=O)CN1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H15ClN2O/c1-12(2)8-14-11(16)7-15(12)10-5-3-9(13)4-6-10/h3-6H,7-8H2,1-2H3,(H,14,16) |
| InChIKey | WOXVPZVUEUXDSX-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.72 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |