C17H16Cl2N2O — CID 68931779
4-[bis(4-chlorophenyl)methyl]piperazin-2-one (PubChem CID 68931779) has the molecular formula C17H16Cl2N2O and a molecular weight of 335.23 g/mol. Its IUPAC name is 4-[bis(4-chlorophenyl)methyl]piperazin-2-one.
| Compound Name | 4-[bis(4-chlorophenyl)methyl]piperazin-2-one |
|---|---|
| PubChem CID | 68931779 |
| Molecular Formula | C17H16Cl2N2O |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 4-[bis(4-chlorophenyl)methyl]piperazin-2-one |
| SMILES | O=C1CN(C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)CCN1 |
| InChI | InChI=1S/C17H16Cl2N2O/c18-14-5-1-12(2-6-14)17(13-3-7-15(19)8-4-13)21-10-9-20-16(22)11-21/h1-8,17H,9-11H2,(H,20,22) |
| InChIKey | IYMOXIMUYCCCAW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |