C14H17FN2 — CID 117024552
1-(3-fluorophenyl)-3,3-dimethylpiperidine-4-carbonitrile (PubChem CID 117024552) has the molecular formula C14H17FN2 and a molecular weight of 232.30 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3,3-dimethylpiperidine-4-carbonitrile.
| Compound Name | 1-(3-fluorophenyl)-3,3-dimethylpiperidine-4-carbonitrile |
|---|---|
| PubChem CID | 117024552 |
| Molecular Formula | C14H17FN2 |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | 1-(3-fluorophenyl)-3,3-dimethylpiperidine-4-carbonitrile |
| SMILES | CC1(C)CN(c2cccc(F)c2)CCC1C#N |
| InChI | InChI=1S/C14H17FN2/c1-14(2)10-17(7-6-11(14)9-16)13-5-3-4-12(15)8-13/h3-5,8,11H,6-7,10H2,1-2H3 |
| InChIKey | SJWHMWYKAWVTSH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |