C15H20N2 — CID 117025414
4,4-dimethyl-1-(2-methylphenyl)piperidine-3-carbonitrile (PubChem CID 117025414) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 4,4-dimethyl-1-(2-methylphenyl)piperidine-3-carbonitrile.
| Compound Name | 4,4-dimethyl-1-(2-methylphenyl)piperidine-3-carbonitrile |
|---|---|
| PubChem CID | 117025414 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 4,4-dimethyl-1-(2-methylphenyl)piperidine-3-carbonitrile |
| SMILES | Cc1ccccc1N1CCC(C)(C)C(C#N)C1 |
| InChI | InChI=1S/C15H20N2/c1-12-6-4-5-7-14(12)17-9-8-15(2,3)13(10-16)11-17/h4-7,13H,8-9,11H2,1-3H3 |
| InChIKey | QRNYHGUJKULGDX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |