C16H20N2O — CID 117025447
1-(3-acetylphenyl)-4,4-dimethylpiperidine-3-carbonitrile (PubChem CID 117025447) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is 1-(3-acetylphenyl)-4,4-dimethylpiperidine-3-carbonitrile.
| Compound Name | 1-(3-acetylphenyl)-4,4-dimethylpiperidine-3-carbonitrile |
|---|---|
| PubChem CID | 117025447 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 1-(3-acetylphenyl)-4,4-dimethylpiperidine-3-carbonitrile |
| SMILES | CC(=O)c1cccc(N2CCC(C)(C)C(C#N)C2)c1 |
| InChI | InChI=1S/C16H20N2O/c1-12(19)13-5-4-6-15(9-13)18-8-7-16(2,3)14(10-17)11-18/h4-6,9,14H,7-8,11H2,1-3H3 |
| InChIKey | WTHRVYONAVXXTJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |