About 2-[4-(aminomethyl)phenyl]-1,1-dioxothiazinan-3-one
2-[4-(aminomethyl)phenyl]-1,1-dioxothiazinan-3-one (PubChem CID 117029956) has the molecular formula C11H14N2O3S
and a molecular weight of 254.31 g/mol. Its IUPAC name is 2-[4-(aminomethyl)phenyl]-1,1-dioxothiazinan-3-one.
Molecular Properties
| Compound Name | 2-[4-(aminomethyl)phenyl]-1,1-dioxothiazinan-3-one |
| PubChem CID | 117029956 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 2-[4-(aminomethyl)phenyl]-1,1-dioxothiazinan-3-one |
| SMILES | NCc1ccc(N2C(=O)CCCS2(=O)=O)cc1 |
| InChI | InChI=1S/C11H14N2O3S/c12-8-9-3-5-10(6-4-9)13-11(14)2-1-7-17(13,15)16/h3-6H,1-2,7-8,12H2 |
| InChIKey | YPWTZOBCFLXZAY-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-(aminomethyl)phenyl]-1,1-dioxothiazinan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(aminomethyl)phenyl]-1,1-dioxothiazinan-3-one?
The IUPAC name of 2-[4-(aminomethyl)phenyl]-1,1-dioxothiazinan-3-one (CID 117029956) is 2-[4-(aminomethyl)phenyl]-1,1-dioxothiazinan-3-one.
What is the SMILES notation for 2-[4-(aminomethyl)phenyl]-1,1-dioxothiazinan-3-one?
The canonical SMILES for 2-[4-(aminomethyl)phenyl]-1,1-dioxothiazinan-3-one is NCc1ccc(N2C(=O)CCCS2(=O)=O)cc1.
What is the InChIKey of 2-[4-(aminomethyl)phenyl]-1,1-dioxothiazinan-3-one?
The InChIKey is YPWTZOBCFLXZAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O3S/c12-8-9-3-5-10(6-4-9)13-11(14)2-1-7-17(13,15)16/h3-6H,1-2,7-8,12H2.
What are the key properties of 2-[4-(aminomethyl)phenyl]-1,1-dioxothiazinan-3-one?
2-[4-(aminomethyl)phenyl]-1,1-dioxothiazinan-3-one has a molecular weight of 254.31 g/mol, XLogP of 0.60, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(aminomethyl)phenyl]-1,1-dioxothiazinan-3-one is sourced from PubChem (CID 117029956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).