C11H11BrN2S — CID 117040915
3-N-(4-bromothiophen-2-yl)-3-N-methylbenzene-1,3-diamine (PubChem CID 117040915) has the molecular formula C11H11BrN2S and a molecular weight of 283.19 g/mol. Its IUPAC name is 3-N-(4-bromothiophen-2-yl)-3-N-methylbenzene-1,3-diamine.
| Compound Name | 3-N-(4-bromothiophen-2-yl)-3-N-methylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 117040915 |
| Molecular Formula | C11H11BrN2S |
| Molecular Weight | 283.19 g/mol |
| Exact Mass | 281.98 |
| IUPAC Name | 3-N-(4-bromothiophen-2-yl)-3-N-methylbenzene-1,3-diamine |
| SMILES | CN(c1cccc(N)c1)c1cc(Br)cs1 |
| InChI | InChI=1S/C11H11BrN2S/c1-14(11-5-8(12)7-15-11)10-4-2-3-9(13)6-10/h2-7H,13H2,1H3 |
| InChIKey | LPNDIFKJROXFBT-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.19 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|