C9H12N4 — CID 117044726
2-[(4,6-dimethylpyrimidin-2-yl)-methylamino]acetonitrile (PubChem CID 117044726) has the molecular formula C9H12N4 and a molecular weight of 176.22 g/mol. Its IUPAC name is 2-[(4,6-dimethylpyrimidin-2-yl)-methylamino]acetonitrile.
| Compound Name | 2-[(4,6-dimethylpyrimidin-2-yl)-methylamino]acetonitrile |
|---|---|
| PubChem CID | 117044726 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 2-[(4,6-dimethylpyrimidin-2-yl)-methylamino]acetonitrile |
| SMILES | Cc1cc(C)nc(N(C)CC#N)n1 |
| InChI | InChI=1S/C9H12N4/c1-7-6-8(2)12-9(11-7)13(3)5-4-10/h6H,5H2,1-3H3 |
| InChIKey | VTUIGFWPNIZCPG-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 52.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|