C10H5F4NO — CID 117045861
2-(4,5,6,7-tetrafluoro-2,3-dihydro-1-benzofuran-2-yl)acetonitrile (PubChem CID 117045861) has the molecular formula C10H5F4NO and a molecular weight of 231.15 g/mol. Its IUPAC name is 2-(4,5,6,7-tetrafluoro-2,3-dihydro-1-benzofuran-2-yl)acetonitrile.
| Compound Name | 2-(4,5,6,7-tetrafluoro-2,3-dihydro-1-benzofuran-2-yl)acetonitrile |
|---|---|
| PubChem CID | 117045861 |
| Molecular Formula | C10H5F4NO |
| Molecular Weight | 231.15 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | 2-(4,5,6,7-tetrafluoro-2,3-dihydro-1-benzofuran-2-yl)acetonitrile |
| SMILES | N#CCC1Cc2c(F)c(F)c(F)c(F)c2O1 |
| InChI | InChI=1S/C10H5F4NO/c11-6-5-3-4(1-2-15)16-10(5)9(14)8(13)7(6)12/h4H,1,3H2 |
| InChIKey | QGONDYGUOGXJMM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.15 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|