C8H5F3N2O3 — CID 117047413
1,1,1-trifluoro-3-(3-nitro-2-pyridinyl)propan-2-one (PubChem CID 117047413) has the molecular formula C8H5F3N2O3 and a molecular weight of 234.13 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-(3-nitro-2-pyridinyl)propan-2-one.
| Compound Name | 1,1,1-trifluoro-3-(3-nitro-2-pyridinyl)propan-2-one |
|---|---|
| PubChem CID | 117047413 |
| Molecular Formula | C8H5F3N2O3 |
| Molecular Weight | 234.13 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 1,1,1-trifluoro-3-(3-nitro-2-pyridinyl)propan-2-one |
| SMILES | O=C(Cc1ncccc1[N+](=O)[O-])C(F)(F)F |
| InChI | InChI=1S/C8H5F3N2O3/c9-8(10,11)7(14)4-5-6(13(15)16)2-1-3-12-5/h1-3H,4H2 |
| InChIKey | SOEXAPIANMPDIM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 73.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.13 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|