C12H8F2N2O2 — CID 58459200
2-[(3,5-difluorophenyl)methyl]-3-nitropyridine (PubChem CID 58459200) has the molecular formula C12H8F2N2O2 and a molecular weight of 250.20 g/mol. Its IUPAC name is 2-[(3,5-difluorophenyl)methyl]-3-nitropyridine.
| Compound Name | 2-[(3,5-difluorophenyl)methyl]-3-nitropyridine |
|---|---|
| PubChem CID | 58459200 |
| Molecular Formula | C12H8F2N2O2 |
| Molecular Weight | 250.20 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 2-[(3,5-difluorophenyl)methyl]-3-nitropyridine |
| SMILES | O=[N+]([O-])c1cccnc1Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H8F2N2O2/c13-9-4-8(5-10(14)7-9)6-11-12(16(17)18)2-1-3-15-11/h1-5,7H,6H2 |
| InChIKey | JUHFUJSLCVYJKJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.20 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|