C16H23N — CID 117048002
2-(4-tert-butylphenyl)-2,3-dimethylbutanenitrile (PubChem CID 117048002) has the molecular formula C16H23N and a molecular weight of 229.37 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-2,3-dimethylbutanenitrile.
| Compound Name | 2-(4-tert-butylphenyl)-2,3-dimethylbutanenitrile |
|---|---|
| PubChem CID | 117048002 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | 2-(4-tert-butylphenyl)-2,3-dimethylbutanenitrile |
| SMILES | CC(C)C(C)(C#N)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H23N/c1-12(2)16(6,11-17)14-9-7-13(8-10-14)15(3,4)5/h7-10,12H,1-6H3 |
| InChIKey | UNIAPILQJXMQGJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |