C11H13ClN2 — CID 87171702
2-(6-chloro-3-pyridinyl)-2,3-dimethylbutanenitrile (PubChem CID 87171702) has the molecular formula C11H13ClN2 and a molecular weight of 208.69 g/mol. Its IUPAC name is 2-(6-chloro-3-pyridinyl)-2,3-dimethylbutanenitrile.
| Compound Name | 2-(6-chloro-3-pyridinyl)-2,3-dimethylbutanenitrile |
|---|---|
| PubChem CID | 87171702 |
| Molecular Formula | C11H13ClN2 |
| Molecular Weight | 208.69 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 2-(6-chloro-3-pyridinyl)-2,3-dimethylbutanenitrile |
| SMILES | CC(C)C(C)(C#N)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C11H13ClN2/c1-8(2)11(3,7-13)9-4-5-10(12)14-6-9/h4-6,8H,1-3H3 |
| InChIKey | LVUBWIITWFRDPH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.69 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|