C24H28N2O4S — CID 11704858
1,1-dioxo-2-(oxolan-2-ylmethyl)-5-phenyl-4-(4-phenylbutylamino)-1,2-thiazol-3-one (PubChem CID 11704858) has the molecular formula C24H28N2O4S and a molecular weight of 440.57 g/mol. Its IUPAC name is 1,1-dioxo-2-(oxolan-2-ylmethyl)-5-phenyl-4-(4-phenylbutylamino)-1,2-thiazol-3-one.
| Compound Name | 1,1-dioxo-2-(oxolan-2-ylmethyl)-5-phenyl-4-(4-phenylbutylamino)-1,2-thiazol-3-one |
|---|---|
| PubChem CID | 11704858 |
| Molecular Formula | C24H28N2O4S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 1,1-dioxo-2-(oxolan-2-ylmethyl)-5-phenyl-4-(4-phenylbutylamino)-1,2-thiazol-3-one |
| SMILES | O=C1C(NCCCCc2ccccc2)=C(c2ccccc2)S(=O)(=O)N1CC1CCCO1 |
| InChI | InChI=1S/C24H28N2O4S/c27-24-22(25-16-8-7-12-19-10-3-1-4-11-19)23(20-13-5-2-6-14-20)31(28,29)26(24)18-21-15-9-17-30-21/h1-6,10-11,13-14,21,25H,7-9,12,15-18H2 |
| InChIKey | MPCXVCINTFSZLF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|