C14H12ClF2NOS — CID 117048928
2-(6-amino-2,3-difluorophenyl)-2-methyl-3-thiophen-2-ylpropanoyl chloride (PubChem CID 117048928) has the molecular formula C14H12ClF2NOS and a molecular weight of 315.77 g/mol. Its IUPAC name is 2-(6-amino-2,3-difluorophenyl)-2-methyl-3-thiophen-2-ylpropanoyl chloride.
| Compound Name | 2-(6-amino-2,3-difluorophenyl)-2-methyl-3-thiophen-2-ylpropanoyl chloride |
|---|---|
| PubChem CID | 117048928 |
| Molecular Formula | C14H12ClF2NOS |
| Molecular Weight | 315.77 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 2-(6-amino-2,3-difluorophenyl)-2-methyl-3-thiophen-2-ylpropanoyl chloride |
| SMILES | CC(Cc1cccs1)(C(=O)Cl)c1c(N)ccc(F)c1F |
| InChI | InChI=1S/C14H12ClF2NOS/c1-14(13(15)19,7-8-3-2-6-20-8)11-10(18)5-4-9(16)12(11)17/h2-6H,7,18H2,1H3 |
| InChIKey | MUMRCEXJSBAYNM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.77 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|