C14H13F2NO2S — CID 117048758
2-(6-amino-2,3-difluorophenyl)-2-methyl-3-thiophen-2-ylpropanoic acid (PubChem CID 117048758) has the molecular formula C14H13F2NO2S and a molecular weight of 297.33 g/mol. Its IUPAC name is 2-(6-amino-2,3-difluorophenyl)-2-methyl-3-thiophen-2-ylpropanoic acid.
| Compound Name | 2-(6-amino-2,3-difluorophenyl)-2-methyl-3-thiophen-2-ylpropanoic acid |
|---|---|
| PubChem CID | 117048758 |
| Molecular Formula | C14H13F2NO2S |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 2-(6-amino-2,3-difluorophenyl)-2-methyl-3-thiophen-2-ylpropanoic acid |
| SMILES | CC(Cc1cccs1)(C(=O)O)c1c(N)ccc(F)c1F |
| InChI | InChI=1S/C14H13F2NO2S/c1-14(13(18)19,7-8-3-2-6-20-8)11-10(17)5-4-9(15)12(11)16/h2-6H,7,17H2,1H3,(H,18,19) |
| InChIKey | CZSYHOALVPRCGN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|