C16H18FNO2S — CID 117048793
ethyl 2-(2-amino-5-fluorophenyl)-2-methyl-3-thiophen-2-ylpropanoate (PubChem CID 117048793) has the molecular formula C16H18FNO2S and a molecular weight of 307.39 g/mol. Its IUPAC name is ethyl 2-(2-amino-5-fluorophenyl)-2-methyl-3-thiophen-2-ylpropanoate.
| Compound Name | ethyl 2-(2-amino-5-fluorophenyl)-2-methyl-3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 117048793 |
| Molecular Formula | C16H18FNO2S |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | ethyl 2-(2-amino-5-fluorophenyl)-2-methyl-3-thiophen-2-ylpropanoate |
| SMILES | CCOC(=O)C(C)(Cc1cccs1)c1cc(F)ccc1N |
| InChI | InChI=1S/C16H18FNO2S/c1-3-20-15(19)16(2,10-12-5-4-8-21-12)13-9-11(17)6-7-14(13)18/h4-9H,3,10,18H2,1-2H3 |
| InChIKey | NZKIBGCNVULLCH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|