C21H18FNO2S — CID 144984337
methyl 1-[4-[4-(3-amino-5-fluorothiophen-2-yl)phenyl]phenyl]cyclopropane-1-carboxylate (PubChem CID 144984337) has the molecular formula C21H18FNO2S and a molecular weight of 367.45 g/mol. Its IUPAC name is methyl 1-[4-[4-(3-amino-5-fluorothiophen-2-yl)phenyl]phenyl]cyclopropane-1-carboxylate.
| Compound Name | methyl 1-[4-[4-(3-amino-5-fluorothiophen-2-yl)phenyl]phenyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 144984337 |
| Molecular Formula | C21H18FNO2S |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | methyl 1-[4-[4-(3-amino-5-fluorothiophen-2-yl)phenyl]phenyl]cyclopropane-1-carboxylate |
| SMILES | COC(=O)C1(c2ccc(-c3ccc(-c4sc(F)cc4N)cc3)cc2)CC1 |
| InChI | InChI=1S/C21H18FNO2S/c1-25-20(24)21(10-11-21)16-8-6-14(7-9-16)13-2-4-15(5-3-13)19-17(23)12-18(22)26-19/h2-9,12H,10-11,23H2,1H3 |
| InChIKey | LDICDMLIZPEWQO-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |