C16H17F2NO2S — CID 117048795
ethyl 2-(6-amino-2,3-difluorophenyl)-2-methyl-3-thiophen-2-ylpropanoate (PubChem CID 117048795) has the molecular formula C16H17F2NO2S and a molecular weight of 325.38 g/mol. Its IUPAC name is ethyl 2-(6-amino-2,3-difluorophenyl)-2-methyl-3-thiophen-2-ylpropanoate.
| Compound Name | ethyl 2-(6-amino-2,3-difluorophenyl)-2-methyl-3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 117048795 |
| Molecular Formula | C16H17F2NO2S |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | ethyl 2-(6-amino-2,3-difluorophenyl)-2-methyl-3-thiophen-2-ylpropanoate |
| SMILES | CCOC(=O)C(C)(Cc1cccs1)c1c(N)ccc(F)c1F |
| InChI | InChI=1S/C16H17F2NO2S/c1-3-21-15(20)16(2,9-10-5-4-8-22-10)13-12(19)7-6-11(17)14(13)18/h4-8H,3,9,19H2,1-2H3 |
| InChIKey | QURREKBSOMPRRR-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|