C15H14F3NO2S — CID 117048759
2-[2-amino-4-(trifluoromethyl)phenyl]-2-methyl-3-thiophen-2-ylpropanoic acid (PubChem CID 117048759) has the molecular formula C15H14F3NO2S and a molecular weight of 329.34 g/mol. Its IUPAC name is 2-[2-amino-4-(trifluoromethyl)phenyl]-2-methyl-3-thiophen-2-ylpropanoic acid.
| Compound Name | 2-[2-amino-4-(trifluoromethyl)phenyl]-2-methyl-3-thiophen-2-ylpropanoic acid |
|---|---|
| PubChem CID | 117048759 |
| Molecular Formula | C15H14F3NO2S |
| Molecular Weight | 329.34 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 2-[2-amino-4-(trifluoromethyl)phenyl]-2-methyl-3-thiophen-2-ylpropanoic acid |
| SMILES | CC(Cc1cccs1)(C(=O)O)c1ccc(C(F)(F)F)cc1N |
| InChI | InChI=1S/C15H14F3NO2S/c1-14(13(20)21,8-10-3-2-6-22-10)11-5-4-9(7-12(11)19)15(16,17)18/h2-7H,8,19H2,1H3,(H,20,21) |
| InChIKey | YACNPEGSEHMTKH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.34 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|