About 2-(3-chloro-4-fluorophenyl)aniline;3-methylthiophene-2-carbonyl chloride
2-(3-chloro-4-fluorophenyl)aniline;3-methylthiophene-2-carbonyl chloride (PubChem CID 142822018) has the molecular formula C18H14Cl2FNOS
and a molecular weight of 382.29 g/mol. Its IUPAC name is 2-(3-chloro-4-fluorophenyl)aniline;3-methylthiophene-2-carbonyl chloride.
Molecular Properties
| Compound Name | 2-(3-chloro-4-fluorophenyl)aniline;3-methylthiophene-2-carbonyl chloride |
| PubChem CID | 142822018 |
| Molecular Formula | C18H14Cl2FNOS |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | 2-(3-chloro-4-fluorophenyl)aniline;3-methylthiophene-2-carbonyl chloride |
| SMILES | Cc1ccsc1C(=O)Cl.Nc1ccccc1-c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C12H9ClFN.C6H5ClOS/c13-10-7-8(5-6-11(10)14)9-3-1-2-4-12(9)15;1-4-2-3-9-5(4)6(7)8/h1-7H,15H2;2-3H,1H3 |
| InChIKey | NJHUEAXPAYBDDI-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-chloro-4-fluorophenyl)aniline;3-methylthiophene-2-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chloro-4-fluorophenyl)aniline;3-methylthiophene-2-carbonyl chloride?
The IUPAC name of 2-(3-chloro-4-fluorophenyl)aniline;3-methylthiophene-2-carbonyl chloride (CID 142822018) is 2-(3-chloro-4-fluorophenyl)aniline;3-methylthiophene-2-carbonyl chloride.
What is the SMILES notation for 2-(3-chloro-4-fluorophenyl)aniline;3-methylthiophene-2-carbonyl chloride?
The canonical SMILES for 2-(3-chloro-4-fluorophenyl)aniline;3-methylthiophene-2-carbonyl chloride is Cc1ccsc1C(=O)Cl.Nc1ccccc1-c1ccc(F)c(Cl)c1.
What is the InChIKey of 2-(3-chloro-4-fluorophenyl)aniline;3-methylthiophene-2-carbonyl chloride?
The InChIKey is NJHUEAXPAYBDDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9ClFN.C6H5ClOS/c13-10-7-8(5-6-11(10)14)9-3-1-2-4-12(9)15;1-4-2-3-9-5(4)6(7)8/h1-7H,15H2;2-3H,1H3.
What are the key properties of 2-(3-chloro-4-fluorophenyl)aniline;3-methylthiophene-2-carbonyl chloride?
2-(3-chloro-4-fluorophenyl)aniline;3-methylthiophene-2-carbonyl chloride has a molecular weight of 382.29 g/mol, XLogP of 6.16, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chloro-4-fluorophenyl)aniline;3-methylthiophene-2-carbonyl chloride is sourced from PubChem (CID 142822018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).