C34H21Cl5I2N2O2S2 — CID 159523658
2-(3,4-dichlorophenyl)aniline;N-[2-(3,4-dichlorophenyl)phenyl]-2-iodothiophene-3-carboxamide;2-iodothiophene-3-carbonyl chloride (PubChem CID 159523658) has the molecular formula C34H21Cl5I2N2O2S2 and a molecular weight of 984.76 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)aniline;N-[2-(3,4-dichlorophenyl)phenyl]-2-iodothiophene-3-carboxamide;2-iodothiophene-3-carbonyl chloride.
| Compound Name | 2-(3,4-dichlorophenyl)aniline;N-[2-(3,4-dichlorophenyl)phenyl]-2-iodothiophene-3-carboxamide;2-iodothiophene-3-carbonyl chloride |
|---|---|
| PubChem CID | 159523658 |
| Molecular Formula | C34H21Cl5I2N2O2S2 |
| Molecular Weight | 984.76 g/mol |
| Exact Mass | 981.76 |
| IUPAC Name | 2-(3,4-dichlorophenyl)aniline;N-[2-(3,4-dichlorophenyl)phenyl]-2-iodothiophene-3-carboxamide;2-iodothiophene-3-carbonyl chloride |
| SMILES | Nc1ccccc1-c1ccc(Cl)c(Cl)c1.O=C(Cl)c1ccsc1I.O=C(Nc1ccccc1-c1ccc(Cl)c(Cl)c1)c1ccsc1I |
| InChI | InChI=1S/C17H10Cl2INOS.C12H9Cl2N.C5H2ClIOS/c18-13-6-5-10(9-14(13)19)11-3-1-2-4-15(11)21-17(22)12-7-8-23-16(12)20;13-10-6-5-8(7-11(10)14)9-3-1-2-4-12(9)15;6-4(8)3-1-2-9-5(3)7/h1-9H,(H,21,22);1-7H,15H2;1-2H |
| InChIKey | MCCUJIZXXIWUAG-UHFFFAOYSA-N |
| XLogP | 13.55 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 984.76 |
| LogP ≤ 5 | 13.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|