C26H34O4S — CID 11704898
(E)-7-[2-[(E)-4-(2,3-dihydro-1-benzothiophen-3-yl)-3-methylbut-1-enyl]-3-hydroxy-6-oxocyclohexyl]hept-5-enoic acid (PubChem CID 11704898) has the molecular formula C26H34O4S and a molecular weight of 442.62 g/mol. Its IUPAC name is (E)-7-[2-[(E)-4-(2,3-dihydro-1-benzothiophen-3-yl)-3-methylbut-1-enyl]-3-hydroxy-6-oxocyclohexyl]hept-5-enoic acid.
| Compound Name | (E)-7-[2-[(E)-4-(2,3-dihydro-1-benzothiophen-3-yl)-3-methylbut-1-enyl]-3-hydroxy-6-oxocyclohexyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 11704898 |
| Molecular Formula | C26H34O4S |
| Molecular Weight | 442.62 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | (E)-7-[2-[(E)-4-(2,3-dihydro-1-benzothiophen-3-yl)-3-methylbut-1-enyl]-3-hydroxy-6-oxocyclohexyl]hept-5-enoic acid |
| SMILES | CC(/C=C/C1C(O)CCC(=O)C1C/C=C/CCCC(=O)O)CC1CSc2ccccc21 |
| InChI | InChI=1S/C26H34O4S/c1-18(16-19-17-31-25-10-7-6-8-20(19)25)12-13-22-21(23(27)14-15-24(22)28)9-4-2-3-5-11-26(29)30/h2,4,6-8,10,12-13,18-19,21-22,24,28H,3,5,9,11,14-17H2,1H3,(H,29,30)/b4-2+,13-12+ |
| InChIKey | LHAULNWYHQLNNL-ZCMUBXDESA-N |
| XLogP | 5.62 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.62 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|