C20H22N4O5 — CID 117054686
(E)-N-[4-(6-methoxypyrazin-2-yl)oxycyclohexyl]-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 117054686) has the molecular formula C20H22N4O5 and a molecular weight of 398.42 g/mol. Its IUPAC name is (E)-N-[4-(6-methoxypyrazin-2-yl)oxycyclohexyl]-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-(6-methoxypyrazin-2-yl)oxycyclohexyl]-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 117054686 |
| Molecular Formula | C20H22N4O5 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | (E)-N-[4-(6-methoxypyrazin-2-yl)oxycyclohexyl]-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | COc1cncc(OC2CCC(NC(=O)/C=C/c3ccc([N+](=O)[O-])cc3)CC2)n1 |
| InChI | InChI=1S/C20H22N4O5/c1-28-19-12-21-13-20(23-19)29-17-9-5-15(6-10-17)22-18(25)11-4-14-2-7-16(8-3-14)24(26)27/h2-4,7-8,11-13,15,17H,5-6,9-10H2,1H3,(H,22,25)/b11-4+ |
| InChIKey | JLCXUVKHRJPRJZ-NYYWCZLTSA-N |
| XLogP | 2.91 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|