C16H24ClN3O3 — CID 117054681
3-chloro-N-[4-(6-methoxypyrazin-2-yl)oxycyclohexyl]-2,2-dimethylpropanamide (PubChem CID 117054681) has the molecular formula C16H24ClN3O3 and a molecular weight of 341.84 g/mol. Its IUPAC name is 3-chloro-N-[4-(6-methoxypyrazin-2-yl)oxycyclohexyl]-2,2-dimethylpropanamide.
| Compound Name | 3-chloro-N-[4-(6-methoxypyrazin-2-yl)oxycyclohexyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 117054681 |
| Molecular Formula | C16H24ClN3O3 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 3-chloro-N-[4-(6-methoxypyrazin-2-yl)oxycyclohexyl]-2,2-dimethylpropanamide |
| SMILES | COc1cncc(OC2CCC(NC(=O)C(C)(C)CCl)CC2)n1 |
| InChI | InChI=1S/C16H24ClN3O3/c1-16(2,10-17)15(21)19-11-4-6-12(7-5-11)23-14-9-18-8-13(20-14)22-3/h8-9,11-12H,4-7,10H2,1-3H3,(H,19,21) |
| InChIKey | URZYVIHYEKOTOE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|