C22H23F3N2O3 — CID 117054585
(E)-3-(4-methoxyphenyl)-N-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]cyclohexyl]prop-2-enamide (PubChem CID 117054585) has the molecular formula C22H23F3N2O3 and a molecular weight of 420.43 g/mol. Its IUPAC name is (E)-3-(4-methoxyphenyl)-N-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]cyclohexyl]prop-2-enamide.
| Compound Name | (E)-3-(4-methoxyphenyl)-N-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]cyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 117054585 |
| Molecular Formula | C22H23F3N2O3 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | (E)-3-(4-methoxyphenyl)-N-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]cyclohexyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)NC2CCC(Oc3ccc(C(F)(F)F)cn3)CC2)cc1 |
| InChI | InChI=1S/C22H23F3N2O3/c1-29-18-8-2-15(3-9-18)4-12-20(28)27-17-6-10-19(11-7-17)30-21-13-5-16(14-26-21)22(23,24)25/h2-5,8-9,12-14,17,19H,6-7,10-11H2,1H3,(H,27,28)/b12-4+ |
| InChIKey | UAFNEBSATBWPML-UUILKARUSA-N |
| XLogP | 4.63 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|