C21H19ClN4O2 — CID 117055065
(E)-3-(4-chlorophenyl)-1-[3-[4-(phenoxymethyl)triazol-1-yl]azetidin-1-yl]prop-2-en-1-one (PubChem CID 117055065) has the molecular formula C21H19ClN4O2 and a molecular weight of 394.86 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-1-[3-[4-(phenoxymethyl)triazol-1-yl]azetidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-chlorophenyl)-1-[3-[4-(phenoxymethyl)triazol-1-yl]azetidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 117055065 |
| Molecular Formula | C21H19ClN4O2 |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-1-[3-[4-(phenoxymethyl)triazol-1-yl]azetidin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1)N1CC(n2cc(COc3ccccc3)nn2)C1 |
| InChI | InChI=1S/C21H19ClN4O2/c22-17-9-6-16(7-10-17)8-11-21(27)25-13-19(14-25)26-12-18(23-24-26)15-28-20-4-2-1-3-5-20/h1-12,19H,13-15H2/b11-8+ |
| InChIKey | HCLRXJIDQZCUGP-DHZHZOJOSA-N |
| XLogP | 3.61 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|