C23H24Cl2N4O3 — CID 154877228
2-(4-chlorophenoxy)-N-[4-[4-[(4-chlorophenoxy)methyl]triazol-1-yl]cyclohexyl]acetamide (PubChem CID 154877228) has the molecular formula C23H24Cl2N4O3 and a molecular weight of 475.38 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[4-[4-[(4-chlorophenoxy)methyl]triazol-1-yl]cyclohexyl]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[4-[4-[(4-chlorophenoxy)methyl]triazol-1-yl]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 154877228 |
| Molecular Formula | C23H24Cl2N4O3 |
| Molecular Weight | 475.38 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[4-[4-[(4-chlorophenoxy)methyl]triazol-1-yl]cyclohexyl]acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1)NC1CCC(n2cc(COc3ccc(Cl)cc3)nn2)CC1 |
| InChI | InChI=1S/C23H24Cl2N4O3/c24-16-1-9-21(10-2-16)31-14-19-13-29(28-27-19)20-7-5-18(6-8-20)26-23(30)15-32-22-11-3-17(25)4-12-22/h1-4,9-13,18,20H,5-8,14-15H2,(H,26,30) |
| InChIKey | WUVOKCHZMAQBIR-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.38 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |