C21H29N5O3 — CID 42368275
N,N-diethyl-1-[4-[(2-phenoxyacetyl)amino]cyclohexyl]triazole-4-carboxamide (PubChem CID 42368275) has the molecular formula C21H29N5O3 and a molecular weight of 399.50 g/mol. Its IUPAC name is N,N-diethyl-1-[4-[(2-phenoxyacetyl)amino]cyclohexyl]triazole-4-carboxamide.
| Compound Name | N,N-diethyl-1-[4-[(2-phenoxyacetyl)amino]cyclohexyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 42368275 |
| Molecular Formula | C21H29N5O3 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | N,N-diethyl-1-[4-[(2-phenoxyacetyl)amino]cyclohexyl]triazole-4-carboxamide |
| SMILES | CCN(CC)C(=O)c1cn(C2CCC(NC(=O)COc3ccccc3)CC2)nn1 |
| InChI | InChI=1S/C21H29N5O3/c1-3-25(4-2)21(28)19-14-26(24-23-19)17-12-10-16(11-13-17)22-20(27)15-29-18-8-6-5-7-9-18/h5-9,14,16-17H,3-4,10-13,15H2,1-2H3,(H,22,27) |
| InChIKey | SIPKGGUIWRMTGM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |