C16H17N7O2S — CID 117055082
1-[1-[(E)-2-phenylethenyl]sulfonylazetidin-3-yl]-4-(triazol-2-ylmethyl)triazole (PubChem CID 117055082) has the molecular formula C16H17N7O2S and a molecular weight of 371.43 g/mol. Its IUPAC name is 1-[1-[(E)-2-phenylethenyl]sulfonylazetidin-3-yl]-4-(triazol-2-ylmethyl)triazole.
| Compound Name | 1-[1-[(E)-2-phenylethenyl]sulfonylazetidin-3-yl]-4-(triazol-2-ylmethyl)triazole |
|---|---|
| PubChem CID | 117055082 |
| Molecular Formula | C16H17N7O2S |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 1-[1-[(E)-2-phenylethenyl]sulfonylazetidin-3-yl]-4-(triazol-2-ylmethyl)triazole |
| SMILES | O=S(=O)(/C=C/c1ccccc1)N1CC(n2cc(Cn3nccn3)nn2)C1 |
| InChI | InChI=1S/C16H17N7O2S/c24-26(25,9-6-14-4-2-1-3-5-14)21-12-16(13-21)22-10-15(19-20-22)11-23-17-7-8-18-23/h1-10,16H,11-13H2/b9-6+ |
| InChIKey | SUGOFZKBHGVQBK-RMKNXTFCSA-N |
| XLogP | 0.78 |
| TPSA | 98.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |