C15H15N7O2 — CID 117055074
(E)-3-(furan-2-yl)-1-[3-[4-(triazol-2-ylmethyl)triazol-1-yl]azetidin-1-yl]prop-2-en-1-one (PubChem CID 117055074) has the molecular formula C15H15N7O2 and a molecular weight of 325.33 g/mol. Its IUPAC name is (E)-3-(furan-2-yl)-1-[3-[4-(triazol-2-ylmethyl)triazol-1-yl]azetidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(furan-2-yl)-1-[3-[4-(triazol-2-ylmethyl)triazol-1-yl]azetidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 117055074 |
| Molecular Formula | C15H15N7O2 |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | (E)-3-(furan-2-yl)-1-[3-[4-(triazol-2-ylmethyl)triazol-1-yl]azetidin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccco1)N1CC(n2cc(Cn3nccn3)nn2)C1 |
| InChI | InChI=1S/C15H15N7O2/c23-15(4-3-14-2-1-7-24-14)20-10-13(11-20)21-8-12(18-19-21)9-22-16-5-6-17-22/h1-8,13H,9-11H2/b4-3+ |
| InChIKey | SDMZICBJUGTXOX-ONEGZZNKSA-N |
| XLogP | 0.61 |
| TPSA | 94.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|