C22H27N5O — CID 117055199
(E)-N-[1-(2-methyl-5,6,7,8-tetrahydroquinazolin-4-yl)piperidin-4-yl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 117055199) has the molecular formula C22H27N5O and a molecular weight of 377.49 g/mol. Its IUPAC name is (E)-N-[1-(2-methyl-5,6,7,8-tetrahydroquinazolin-4-yl)piperidin-4-yl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-[1-(2-methyl-5,6,7,8-tetrahydroquinazolin-4-yl)piperidin-4-yl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 117055199 |
| Molecular Formula | C22H27N5O |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | (E)-N-[1-(2-methyl-5,6,7,8-tetrahydroquinazolin-4-yl)piperidin-4-yl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | Cc1nc2c(c(N3CCC(NC(=O)/C=C/c4cccnc4)CC3)n1)CCCC2 |
| InChI | InChI=1S/C22H27N5O/c1-16-24-20-7-3-2-6-19(20)22(25-16)27-13-10-18(11-14-27)26-21(28)9-8-17-5-4-12-23-15-17/h4-5,8-9,12,15,18H,2-3,6-7,10-11,13-14H2,1H3,(H,26,28)/b9-8+ |
| InChIKey | MEYKZEQAXIAKTC-CMDGGOBGSA-N |
| XLogP | 2.86 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|