C10H10ClN3OS — CID 117060431
S-(4,5-dihydro-1H-imidazol-2-yl) N-(4-chlorophenyl)carbamothioate (PubChem CID 117060431) has the molecular formula C10H10ClN3OS and a molecular weight of 255.73 g/mol. Its IUPAC name is S-(4,5-dihydro-1H-imidazol-2-yl) N-(4-chlorophenyl)carbamothioate.
| Compound Name | S-(4,5-dihydro-1H-imidazol-2-yl) N-(4-chlorophenyl)carbamothioate |
|---|---|
| PubChem CID | 117060431 |
| Molecular Formula | C10H10ClN3OS |
| Molecular Weight | 255.73 g/mol |
| Exact Mass | 255.02 |
| IUPAC Name | S-(4,5-dihydro-1H-imidazol-2-yl) N-(4-chlorophenyl)carbamothioate |
| SMILES | O=C(Nc1ccc(Cl)cc1)SC1=NCCN1 |
| InChI | InChI=1S/C10H10ClN3OS/c11-7-1-3-8(4-2-7)14-10(15)16-9-12-5-6-13-9/h1-4H,5-6H2,(H,12,13)(H,14,15) |
| InChIKey | GZBVTRHQTFCJOB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.73 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|