C12H13BrClN3O — CID 165350444
1-(5-bromo-2,3,4,5-tetrahydropyridin-6-yl)-3-(4-chlorophenyl)urea (PubChem CID 165350444) has the molecular formula C12H13BrClN3O and a molecular weight of 330.61 g/mol. Its IUPAC name is 1-(5-bromo-2,3,4,5-tetrahydropyridin-6-yl)-3-(4-chlorophenyl)urea.
| Compound Name | 1-(5-bromo-2,3,4,5-tetrahydropyridin-6-yl)-3-(4-chlorophenyl)urea |
|---|---|
| PubChem CID | 165350444 |
| Molecular Formula | C12H13BrClN3O |
| Molecular Weight | 330.61 g/mol |
| Exact Mass | 328.99 |
| IUPAC Name | 1-(5-bromo-2,3,4,5-tetrahydropyridin-6-yl)-3-(4-chlorophenyl)urea |
| SMILES | O=C(NC1=NCCCC1Br)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H13BrClN3O/c13-10-2-1-7-15-11(10)17-12(18)16-9-5-3-8(14)4-6-9/h3-6,10H,1-2,7H2,(H2,15,16,17,18) |
| InChIKey | DJDUJSSGBAICAI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.61 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|