C7H2Cl2O2S2 — CID 117061645
2,4-dichlorothieno[2,3-b]thiophene-5-carboxylic acid (PubChem CID 117061645) has the molecular formula C7H2Cl2O2S2 and a molecular weight of 253.13 g/mol. Its IUPAC name is 2,4-dichlorothieno[2,3-b]thiophene-5-carboxylic acid.
| Compound Name | 2,4-dichlorothieno[2,3-b]thiophene-5-carboxylic acid |
|---|---|
| PubChem CID | 117061645 |
| Molecular Formula | C7H2Cl2O2S2 |
| Molecular Weight | 253.13 g/mol |
| Exact Mass | 251.89 |
| IUPAC Name | 2,4-dichlorothieno[2,3-b]thiophene-5-carboxylic acid |
| SMILES | O=C(O)c1sc2sc(Cl)cc2c1Cl |
| InChI | InChI=1S/C7H2Cl2O2S2/c8-3-1-2-4(9)5(6(10)11)13-7(2)12-3/h1H,(H,10,11) |
| InChIKey | YQLDASRFXWVJKA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.13 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |