C14H15ClO4S — CID 91756295
3-chloro-6-(diethoxymethyl)-1-benzothiophene-2-carboxylic acid (PubChem CID 91756295) has the molecular formula C14H15ClO4S and a molecular weight of 314.79 g/mol. Its IUPAC name is 3-chloro-6-(diethoxymethyl)-1-benzothiophene-2-carboxylic acid.
| Compound Name | 3-chloro-6-(diethoxymethyl)-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 91756295 |
| Molecular Formula | C14H15ClO4S |
| Molecular Weight | 314.79 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 3-chloro-6-(diethoxymethyl)-1-benzothiophene-2-carboxylic acid |
| SMILES | CCOC(OCC)c1ccc2c(Cl)c(C(=O)O)sc2c1 |
| InChI | InChI=1S/C14H15ClO4S/c1-3-18-14(19-4-2)8-5-6-9-10(7-8)20-12(11(9)15)13(16)17/h5-7,14H,3-4H2,1-2H3,(H,16,17) |
| InChIKey | QPQRKNDOWNXZLQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.79 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|